Home
Products
Acetyleugenol
| Product Name | Acetyleugenol |
| Price: | $46 / 100mg |
| Catalog No.: | CN03349 |
| CAS No.: | 93-28-7 |
| Molecular Formula: | C12H14O3 |
| Molecular Weight: | 206.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The air-dried buds of Eugenia caryophyllata THUMBEDG. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C=CCc1ccc(c(c1)OC)OC(=O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Eugenol acetate (Eugenyl acetate), a major phytochemical constituent of the essential oil exhibits antibacterial, antioxidant, and anti-virulence activities. Eugenol acetate (Eugenyl acetate), a phytochemical in clove essential oil, against clinical isolates of Candida albicans, Candida parapsilosis, Candida tropicalis, and Candida glabrata. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 268.0±28.0 °C at 760 mmHg |
| Flash Point | 106.8±18.6 °C |
| Exact Mass | 206.094299 |
| PSA | 35.53000 |
| LogP | 2.40 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |