Home
Products
Viscidulin I
| Product Name | Viscidulin I |
| Price: | $336 / 5mg |
| Catalog No.: | CN05233 |
| CAS No.: | 92519-95-4 |
| Molecular Formula: | C15H10O7 |
| Molecular Weight: | 302.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The roots of Scutellaria viscidula Bge. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1cc(O)c2c(c1)oc(c(c2=O)O)c1c(O)cccc1O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Viscidulin I is found in Scutellaria baicalensis Georgi[1]. |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 588.3±50.0 °C at 760 mmHg |
| Flash Point | 227.0±23.6 °C |
| Exact Mass | 302.042664 |
| PSA | 131.36000 |
| LogP | 1.93 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |