Home
Products
4'-Methoxypuerarin
| Product Name | 4'-Methoxypuerarin |
| Price: | $366 / 10mg |
| Catalog No.: | CN04846 |
| CAS No.: | 92117-94-7 |
| Molecular Formula: | C22H22O9 |
| Molecular Weight: | 430.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Pueraria lobata |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@H]([C@@H]([C@H]([C@@H]1O)O)O)c1c(O)ccc2c1occ(c2=O)c1ccc(cc1)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 4'-Methoxypuerarin (4'-O-Methylpuerarin), an isoflavone diglycoside, is isolated from Pueraria lobata[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 661.7±55.0 °C at 760 mmHg |
| Flash Point | 232.2±25.0 °C |
| Exact Mass | 430.126373 |
| PSA | 149.82000 |
| LogP | 2.14 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |