Home
Products
Saikosaponin H
| Product Name | Saikosaponin H |
| Price: | $511 / 5mg |
| Catalog No.: | CN07393 |
| CAS No.: | 91990-63-5 |
| Molecular Formula: | C48H78O17 |
| Molecular Weight: | 927.12 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Bupleurum chinense |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OCC2OC(OC3CCC4(C(C3(C)C)CCC3(C4C=CC4=C5CC(C)(C)CCC5(C(CC34C)O)CO)C)C)C(C(C2OC2OC(C)C(C(C2O)O)O)O)O)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Saikosaponin H is a saikosaponin derived from the herb Radix bupleuri[1]. |
| Density | 1.40±0.1 g/cm3 |
| Boiling Point | 1012.1±65.0 °C |
| Exact Mass | 926.52400 |
| PSA | 277.91000 |
| LogP | 0.53240 |
| Storage condition | 2-8°C |