Home
Products
Zingiberen newsaponin
| Product Name | Zingiberen newsaponin |
| Price: | $351 / 5mg |
| Catalog No.: | CN02404 |
| CAS No.: | 91653-50-8 |
| Molecular Formula: | C51H82O22 |
| Molecular Weight: | 1047.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Paris yunnanensis Franch. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OC2CCC3=CCC4C(C3(C2)C)CCC2(C4CC3C2C(C)C2(O3)CCC(CO2)C)C)C(C(C1OC1OC(CO)C(C(C1O)OC1OC(CO)C(C(C1O)O)O)O)O)OC1OC(C)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Zingiberen Newsaponin is extracted from isolated from Dioscorea zingiberensis. Zingiberen Newsaponin exhibits induction effect on platelet aggregation[1]. |
| Density | 1.5±0.1 g/cm3 |
| Exact Mass | 1046.529785 |
| PSA | 335.06000 |
| LogP | 4.38 |
| Storage condition | 2-8℃ |