Home
Products
Rubitecan
| Product Name | Rubitecan |
| Price: | Inquiry |
| Catalog No.: | CN00778 |
| CAS No.: | 91421-42-0 |
| Molecular Formula: | C20H15N3O6 |
| Molecular Weight: | 393.35 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The barks of Camptotheca acuminata Decne. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC[C@@]1(O)C(=O)OCc2c1cc1c3nc4cccc(c4cc3Cn1c2=O)[N+](=O)[O-] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Rubitecan (RFS 2000), a camptothecin derivative, is an orally active topoisomerase I inhibitor with broad antitumor activity, and induces protein-linked DNA single-strand breaks, thereby blocking DNA and RNA synthesis in dividing cells[1][2][3]. |
| Target | Topoisomerase I[1] |
| In Vitro | Rubitecan (RFS 2000) inhibits U-CH1, U-CH2, and CCL4 cells with IC50s 0.32, 0.83, and 7.7 µM, respectively[4]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 816.3±65.0 °C at 760 mmHg |
| Flash Point | 447.5±34.3 °C |
| Exact Mass | 393.096100 |
| PSA | 127.24000 |
| LogP | 1.38 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |
| Storage condition | Room temp |