Home
Products
Cryptochlorogenic acid
| Product Name | Cryptochlorogenic acid |
| Price: | $62 / 20mg |
| Catalog No.: | CN07040 |
| CAS No.: | 905-99-7 |
| Molecular Formula: | C16H18O9 |
| Molecular Weight: | 354.31 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The flowerbud of Lonicera japonica Thunb. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O=C(O[C@@H]1[C@H](O)C[C@@](C[C@H]1O)(O)C(=O)O)/C=C/c1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cryptochlorogenic acid is a natural product. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 694.9±55.0 °C at 760 mmHg |
| Flash Point | 256.8±25.0 °C |
| Exact Mass | 354.095093 |
| PSA | 164.75000 |
| LogP | -0.97 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Storage condition | ?20°C |