Home
Products
Maoyerabdosin
| Product Name | Maoyerabdosin |
| Price: | Inquiry |
| Catalog No.: | CN08518 |
| CAS No.: | 90468-72-7 |
| Molecular Formula: | C24H36O9 |
| Molecular Weight: | 468.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Isodon japonica |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)OC[C@@]1(O)[C@@H]2CC[C@@H]3[C@]([C@@H]1O)(C2)[C@]1(O)OC[C@@]23[C@H](O)CCC([C@H]2[C@@H]1OC(=O)C)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Maoyerabdosin is a compound isolated from the leaves of Isodon japonica[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 607.4±55.0 °C at 760 mmHg |
| Flash Point | 202.3±25.0 °C |
| Exact Mass | 468.235931 |
| PSA | 142.75000 |
| LogP | 1.12 |
| Vapour Pressure | 0.0±3.9 mmHg at 25°C |