Home
Products
7-Xylosyltaxol
| Product Name | 7-Xylosyltaxol |
| Price: | Inquiry |
| Catalog No.: | CN08841 |
| CAS No.: | 90332-66-4 |
| Molecular Formula: | C52H59NO18 |
| Molecular Weight: | 986.0 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Yellow powder |
| Source: | The barks of Taxus baccata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)O[C@H]1C(=O)[C@]2(C)[C@@H](OC3OC[C@H]([C@@H]([C@H]3O)O)O)C[C@@H]3[C@]([C@H]2[C@@H]([C@]2(C(C1=C(C)[C@@H](OC(=O)[C@@H]([C@H](c1ccccc1)NC(=O)c1ccccc1)O)C2)(C)C)O)OC(=O)c1ccccc1)(CO3)OC(=O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 7-xylosyltaxol(Taxol-7-xyloside) is a taxol (Paclitaxel) derivative; Paclitaxel binds to tubulin and inhibits the disassembly of microtubules.IC50 Value:Target: Microtubule/TubulinPaclitaxel is a compound extracted from the Pacific yew tree with antineoplastic activity. Paclitaxel also induces apoptosis by binding to and blocking the function of the apoptosis inhibitor protein Bcl-2 (B-cell Leukemia 2). Paclitaxel inhibits DNA synthesis and stimulates the release of tumor necrosis factor-α. Paclitaxel induces apoptosis in murine mammary carcinoma MCA-4 and ovarian carcinoma OCA-1 tumors. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 1062.3±65.0 °C at 760 mmHg |
| Flash Point | 596.3±34.3 °C |
| Exact Mass | 985.373230 |
| LogP | 7.81 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2-8℃ |