Home
Products
7-Xylosyl-10-deacetyltaxol C
| Product Name | 7-Xylosyl-10-deacetyltaxol C |
| Price: | Inquiry |
| Catalog No.: | CN08297 |
| CAS No.: | 90332-65-3 |
| Molecular Formula: | C49H63NO17 |
| Molecular Weight: | 938.02 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The barks of Taxus wallichiana Zucc. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | CCCCCC(=O)NC(C(C(=O)OC1CC2(O)C(OC(=O)c3ccccc3)C3C(C(=O)C(C(=C1C)C2(C)C)O)(C)C(OC1OCC(C(C1O)O)O)CC1C3(CO1)OC(=O)C)O)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 7-Xylosyl-10-Deacetyltaxol C (7-Xylosyl-10-Deacetylpaclitaxel C) is a paclitaxel derivative derived from T. cuspidate. 7-Xylosyl-10-Deacetyltaxol C has anti-tumor activity and inhibits the growth of S180 sarcoma[1]. |
| Density | 1.41±0.1g/ml |
| Exact Mass | 937.41000 |
| PSA | 274.14000 |
| LogP | 2.28560 |