Home
Products
7-Xylosyl-10-deacetyltaxol B
| Product Name | 7-Xylosyl-10-deacetyltaxol B |
| Price: | Inquiry |
| Catalog No.: | CN08296 |
| CAS No.: | 90332-64-2 |
| Molecular Formula: | C48H59NO17 |
| Molecular Weight: | 921.97 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The barks of Taxus wallichiana Zucc. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | CC=C(C(=O)NC(C(C(=O)OC1CC2(O)C(OC(=O)c3ccccc3)C3C(C(=O)C(C(=C1C)C2(C)C)O)(C)C(OC1OCC(C(C1O)O)O)CC1C3(CO1)OC(=O)C)O)c1ccccc1)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 7-Xylosyl-10-Deacetyltaxol B (7-xylosyl-10-Deacetylpaclitaxel B) is a paclitaxel derivative derived from T. cuspidate. 7-Xylosyl-10-Deacetyltaxol B has anti-tumor activity and inhibits the growth of S180 sarcoma[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 1041.3±65.0 °C at 760 mmHg |
| Flash Point | 583.5±34.3 °C |
| Exact Mass | 921.37800 |
| PSA | 274.14000 |
| LogP | 6.39 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |