Home
Products
3,4,5-Trimethoxycinnamic acid
| Product Name | 3,4,5-Trimethoxycinnamic acid |
| Price: | $15 / 20mg |
| Catalog No.: | CN06980 |
| CAS No.: | 90-50-6 |
| Molecular Formula: | C12H14O5 |
| Molecular Weight: | 238.24 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | White cryst. |
| Source: | The heartwoods of Cassia garrettiana |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(C=CC(=O)O)cc(c1OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3,4,5-Trimethoxycinnamic acid is a phenylpropanoid isolated from the roots of Polygala tenuifoliaWILLD, with anti-stress effect, prolonging the sleeping time in animals[1][2]. 3,4,5-Trimethoxycinnamic acid increases expression of GAD65 and γ-subunit of GABAA receptor, but shows no effect on the amounts of α-, β-subunits[2]. |
| Target | γ-subunit of GABAA receptor[2] |
| In Vitro | 3,4,5-Trimethoxycinnamic acid (10 μg/ml) increases expression of GAD65 and γ-subunit of GABAA receptor, but shows no effect on the amounts of α-, β-subunits[2]. |
| In Vivo | 3,4,5-Trimethoxycinnamic acid (25-100 mg/kg, i.p.) exhibits sedative effect, and prolongs the sleeping time in rats[1]. 3,4,5-Trimethoxycinnamic acid (10 mg/kg, p.o.) significantly decreases locomotor activity in mice[2]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 396.4±37.0 °C at 760 mmHg |
| Flash Point | 151.5±20.0 °C |
| Exact Mass | 238.084122 |
| PSA | 64.99000 |
| LogP | 2.00 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |