Home
Products
beta-Rhamnocitrin
| Product Name | beta-Rhamnocitrin |
| Price: | $190 / 5mg |
| Catalog No.: | CN05063 |
| CAS No.: | 90-19-7 |
| Molecular Formula: | C16H12O7 |
| Molecular Weight: | 316.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The branches of Rhamnus cathartica |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(O)c2c(c1)oc(c(c2=O)O)c1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Rhamnetin is a quercetin derivative found in Coriandrum sativum, inhibits secretory phospholipase A2, with antioxidant and anti-inflammatory activity[1]. |
| Density | 1.634g/cm3 |
| Boiling Point | 627.9ºC at 760 mmHg |
| Flash Point | 238.9ºC |
| Exact Mass | 316.05800 |
| PSA | 120.36000 |
| LogP | 2.29100 |
| Storage condition | 2-8°C |