Home
Products
3,5-di-O-caffeoylquinic acid
| Product Name | 3,5-di-O-caffeoylquinic acid |
| Price: | $62 / 20mg |
| Catalog No.: | CN06789 |
| CAS No.: | 89919-62-0 |
| Molecular Formula: | C25H24O12 |
| Molecular Weight: | 516.45 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The subaerial parts of Scorzonera pygmaea Sibth. & Sm. (Asteraceae). |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O=C(O[C@@H]1C[C@](O)(C[C@H]([C@H]1O)OC(=O)/C=C/c1ccc(c(c1)O)O)C(=O)O)/C=C/c1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3,5-O-Dicaffeoylquinic acid reverses Trimethyltin-induced learning and memory deficits[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 826.2±65.0 °C at 760 mmHg |
| Flash Point | 280.4±27.8 °C |
| Exact Mass | 516.126770 |
| PSA | 211.28000 |
| LogP | 1.05 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |
| Storage condition | 2~8℃ |