Home
Products
3-O-Acetyl-alpha-boswellic acid
| Product Name | 3-O-Acetyl-alpha-boswellic acid |
| Price: | $511 / 10mg |
| Catalog No.: | CN07632 |
| CAS No.: | 89913-60-0 |
| Molecular Formula: | C32H50O4 |
| Molecular Weight: | 498.74 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Boswellia carterii Birdw. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)O[C@@H]1CC[C@]2([C@H]([C@@]1(C)C(=O)O)CC[C@@]1([C@@H]2CC=C2[C@@]1(C)CC[C@@]1([C@H]2CC(C)(C)CC1)C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3-O-Acetyl-α-boswellic acid suppresses T cell function[1]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 563.6±50.0 °C at 760 mmHg |
| Flash Point | 170.1±23.6 °C |
| Exact Mass | 498.370911 |
| PSA | 63.60000 |
| LogP | 10.32 |
| Vapour Pressure | 0.0±3.3 mmHg at 25°C |