Home
Products
8-Acetyl-7-methoxycoumarin
| Product Name | 8-Acetyl-7-methoxycoumarin |
| Price: | Inquiry |
| Catalog No.: | CN06029 |
| CAS No.: | 89019-07-8 |
| Molecular Formula: | C12H10O4 |
| Molecular Weight: | 218.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The herbs of Murraya paniculata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc2c(c1C(=O)C)oc(=O)cc2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.264g/cm3 |
| Boiling Point | 419.9ºC at 760 mmHg |
| Flash Point | 191ºC |
| Exact Mass | 218.05800 |
| PSA | 56.51000 |
| LogP | 2.00420 |