Home
Products
Dipsanoside B
| Product Name | Dipsanoside B |
| Price: | $380 / 5mg |
| Catalog No.: | CN03087 |
| CAS No.: | 889678-64-2 |
| Molecular Formula: | C66H90O37 |
| Molecular Weight: | 1475.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Powder |
| Source: | The roots of Dipsacus asperoides |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OC2OC=C(C(C2C=C)CC=C(C2C(C=C)C(OC=C2C(=O)OC2CC3C(C2C)C(OC=C3C(=O)OC)OC2OC(CO)C(C(C2O)O)O)OC2OC(CO)C(C(C2O)O)O)C=O)C(=O)OC2CC3C(C2C)C(OC=C3C(=O)OC)OC2OC(CO)C(C(C2O)O)O)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Dipsanoside B is a novel tetrairidoid glucoside from Dipsacus asper. Dipsacus asper Wall., a perennial plant widespread in China, has been used in traditional Chinese medicine for hundreds of years as a tonic for refreshment, as a fissiparism promoter of the osseous cells, and as an embryo security agent, etc[1]. |
| Density | 1.6±0.0 g/cm3 |
| Exact Mass | 1474.516094 |
| PSA | 556.71000 |
| LogP | -7.69 |