Home
Products
Piperlotine C
| Product Name | Piperlotine C |
| Price: | $277 / 10mg |
| Catalog No.: | CN01008 |
| CAS No.: | 886989-88-4 |
| Molecular Formula: | C16H21NO4 |
| Molecular Weight: | 291.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Piper nigrum L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(/C=C/C(=O)N2CCCC2)cc(c1OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Piperlotine C is an alkaloid isolated from Piper lolot, with anti-platelet aggregation induced by arachidonic acid, and the IC50 is 26.6 µg/mL[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 482.8±45.0 °C at 760 mmHg |
| Flash Point | 245.8±28.7 °C |
| Exact Mass | 291.147064 |
| PSA | 48.00000 |
| LogP | 1.76 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |