Home
Products
8-Epideoxyloganic acid
| Product Name | 8-Epideoxyloganic acid |
| Price: | Inquiry |
| Catalog No.: | CN03081 |
| CAS No.: | 88668-99-9 |
| Molecular Formula: | C16H24O9 |
| Molecular Weight: | 360.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Lamiophlomis rotata. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1OC(O[C@@H]2OC=C([C@@H]3[C@H]2[C@H](C)CC3)C(=O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 8-Epideoxyloganic acid (7-Deoxy-8-epiloganic acid), an iridoid glucoside, can be found in Incarvillea delavayi. 8-Epideoxyloganic acid exhibits weak antinociceptive activity[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 597.2±50.0 °C at 760 mmHg |
| Flash Point | 217.9±23.6 °C |
| Exact Mass | 360.142029 |
| PSA | 145.91000 |
| LogP | -0.97 |
| Vapour Pressure | 0.0±3.8 mmHg at 25°C |