Home
Products
Rosamultin
| Product Name | Rosamultin |
| Price: | $103 / 10mg |
| Catalog No.: | CN07423 |
| CAS No.: | 88515-58-6 |
| Molecular Formula: | C36H58O10 |
| Molecular Weight: | 650.85 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Rosa rugosa. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](OC(=O)C23CCC([C@@]([C@H]3C3=CC[C@H]4C(C3(CC2)C)(C)CC[C@@H]2[C@]4(C)C[C@H]([C@@H](C2(C)C)O)O)(C)O)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Rosamultin is a 19 α-hydroxyursane-type triterpenoid isolated from Potentilla anserina L. Rosamultin has inhibitory effects against HIV-1 protease[1]. Rosamultin has the potential for treating H2O2-induced oxidative stress injury through its antioxidant and antiapoptosis effects[2]. |
| Target | IC50: HIV-1 protease[1] |
| In Vitro | Rosamultin isolated from the root of R. rugosa inhibits HIV-1 protease by 53% at a concentration of 100 μM[1]. |
| Density | 1.31g/cm3 |
| Boiling Point | 741.5ºC at 760 mmHg |
| Flash Point | 223.6ºC |
| Exact Mass | 650.40300 |
| PSA | 177.14000 |
| LogP | 2.43370 |