Home
Products
Methyl syringate
| Product Name | Methyl syringate |
| Price: | Inquiry |
| Catalog No.: | CN03960 |
| CAS No.: | 884-35-5 |
| Molecular Formula: | C10H12O5 |
| Molecular Weight: | 212.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The herbs of Illicium micranthum. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC(=O)c1cc(OC)c(c(c1)OC)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Methyl syringate, a chemical marker of asphodel monofloral honey, is an efficient phenolic mediator for bacterial and fungal laccases. Methyl syringate is a TRPA1 agonist[1][2][3]. |
| Target | TRPA1[3]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 339.9±37.0 °C at 760 mmHg |
| Flash Point | 132.4±20.0 °C |
| Exact Mass | 212.068466 |
| PSA | 64.99000 |
| LogP | 1.10 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |