Home
Products
Levistilide A
| Product Name | Levistilide A |
| Price: | $103 / 20mg |
| Catalog No.: | CN06716 |
| CAS No.: | 88182-33-6 |
| Molecular Formula: | C24H28O4 |
| Molecular Weight: | 380.48 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Solid |
| Source: | The roots of Angelica sinensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCCC=C1OC(=O)C2=C1CCC1C2C23CCC1C=C3C(=O)OC2=CCCC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Levistolide A (LA), a natural compound isolated from the traditional Chinese herb Ligusticum chuanxiong Hort, is used for treating cancer. Levistolide A can induce apoptosis via ROS-mediated ER stress pathway[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 623.8±55.0 °C at 760 mmHg |
| Flash Point | 325.7±29.9 °C |
| Exact Mass | 380.198761 |
| PSA | 52.60000 |
| LogP | 5.11 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |