Home
Products
Notoginsenoside Fe
| Product Name | Notoginsenoside Fe |
| Price: | $190 / 20mg |
| Catalog No.: | CN07527 |
| CAS No.: | 88105-29-7 |
| Molecular Formula: | C47H80O17 |
| Molecular Weight: | 917.12 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Panax notoginseng |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@@H]1O[C@H]([C@@H]([C@H]1O)O)OC[C@H]1O[C@@H](O[C@]([C@H]2CC[C@@]3([C@@H]2[C@H](O)C[C@H]2[C@@]3(C)CC[C@@H]3[C@]2(C)CC[C@@H](C3(C)C)O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)C)(CCC=C(C)C)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Notoginsenoside Fe is a natural compound isolated from Panax japlcus var. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 994.1±65.0 °C at 760 mmHg |
| Flash Point | 555.0±34.3 °C |
| Exact Mass | 916.539551 |
| PSA | 277.91000 |
| LogP | 5.61 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |