Home
Products
4-Hydroxyphenethylanisate
| Product Name | 4-Hydroxyphenethylanisate |
| Price: | $146 / 5mg |
| Catalog No.: | CN06820 |
| CAS No.: | 87932-34-1 |
| Molecular Formula: | C16H16O4 |
| Molecular Weight: | 272.30 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The underground parts of Notopterygium forbe-siiBoiss. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1)C(=O)OCCc1ccc(cc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | p-Hydroxyphenethyl anisate is a main constituent of Notopterygium Radix[1]. |
| Density | 1.199±0.06 g/cm3 |
| Boiling Point | 446.5±30.0 °C at 760 mmHg |
| Flash Point | 165.4±18.1 °C |
| Exact Mass | 272.104858 |
| PSA | 55.76000 |
| LogP | 3.56 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |