Home
Products
Eupalinolide A
| Product Name | Eupalinolide A |
| Price: | $176 / 20mg |
| Catalog No.: | CN09348 |
| CAS No.: | 877822-41-8 |
| Molecular Formula: | C24H30O9 |
| Molecular Weight: | 462.49 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Cryst. |
| Source: | The herbs of Eupatorium lindleyanum DC. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC/C=C(/C(=O)O[C@@H]1CC(=CC[C@@H](C(=C[C@@H]2[C@@H]1C(=C)C(=O)O2)C)OC(=O)C)COC(=O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Eupalinolide B is a germacrane sesquiterpene isolated from Eupatorium lindleyanum. Eupalinolide B demonstrates potent cytotoxicity against A-549, BGC-823 and HL-60 tumour cell lines[1]. |
| Density | 1.24±0.1 g/cm3 (20 ºC 760 Torr) |
| Boiling Point | 618.6±55.0 °C at 760 mmHg |
| Flash Point | 205.4±25.0 °C |
| Exact Mass | 462.188995 |
| PSA | 125.43000 |
| LogP | 2.50 |
| Vapour Pressure | 0.0±4.1 mmHg at 25°C |