Home
Products
Eupalinolide B
| Product Name | Eupalinolide B |
| Price: | $117 / 20mg |
| Catalog No.: | CN09347 |
| CAS No.: | 877822-40-7 |
| Molecular Formula: | C24H30O9 |
| Molecular Weight: | 462.49 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Oil |
| Source: | The herbs of Eupatorium lindleyanum DC. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC/C=C(/C(=O)O[C@@H]1C/C(=CC[C@@H](/C(=C[C@@H]2[C@@H]1C(=C)C(=O)O2)/C)OC(=O)C)/COC(=O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Eupalinolide A, isolated from Eupatorium lindleyanum, induces the expression of HSP70 via the activation of HSF1 by inhibiting the interaction between HSF1 and HSP90[1]. |
| Target | HSF1 |
| Density | 1.24±0.1 g/cm3 (20 ºC 760 Torr) |
| Boiling Point | 618.6±55.0 °C at 760 mmHg |
| Flash Point | 205.4±25.0 °C |
| Exact Mass | 462.188995 |
| PSA | 125.43000 |
| LogP | 2.50 |
| Vapour Pressure | 0.0±4.1 mmHg at 25°C |
| Storage condition | 2-8°C |