Home
Products
Alismoxide
| Product Name | Alismoxide |
| Price: | $176 / 20mg |
| Catalog No.: | CN09504 |
| CAS No.: | 87701-68-6 |
| Molecular Formula: | C15H26O2 |
| Molecular Weight: | 238.37 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Oil |
| Source: | The tubers of Alisma plantago-aquatica. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(C1=C[C@H]2[C@H]([C@](CC1)(C)O)CC[C@]2(C)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Alismoxide is a natural product. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 343.2±42.0 °C at 760 mmHg |
| Flash Point | 153.9±22.5 °C |
| Exact Mass | 238.193283 |
| PSA | 40.46000 |
| LogP | 3.42 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Storage condition | -20°C |