Home
Products
Smyrindioloside
| Product Name | Smyrindioloside |
| Price: | $351 / 5mg |
| Catalog No.: | CN06223 |
| CAS No.: | 87592-77-6 |
| Molecular Formula: | C20H24O10 |
| Molecular Weight: | 424.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The roots of Heracleum stenopterum |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OC(C2Oc3c(C2O)cc2c(c3)oc(=O)cc2)(C)C)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Smyrindioloside is a natural product isolated from the bark of Streblus indicus[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 685.8±55.0 °C at 760 mmHg |
| Flash Point | 243.3±25.0 °C |
| Exact Mass | 424.136932 |
| PSA | 159.05000 |
| LogP | -1.86 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |