Home
Products
Dimethyl lithospermate B
| Product Name | Dimethyl lithospermate B |
| Price: | $204 / 10mg |
| Catalog No.: | CN06867 |
| CAS No.: | 875313-64-7 |
| Molecular Formula: | C38H34O16 |
| Molecular Weight: | 746.67 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The roots of Salvia miltiorrhiza Bge. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | COC(=O)C(Cc1ccc(c(c1)O)O)OC(=O)C=Cc1ccc(c2c1C(C(=O)OC(C(=O)OC)Cc1ccc(c(c1)O)O)C(O2)c1ccc(c(c1)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Dimethyl lithospermate B (dmLSB) is a selective Na+ channel agonist. Dimethyl lithospermate B slows inactivation of sodium current (INa), leading to increased inward current during the early phases of the action potential (AP)[1][2]. |
| Target | Na+ channel[1] |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 968.3±65.0 °C at 760 mmHg |
| Flash Point | 300.5±27.8 °C |
| Exact Mass | 746.184692 |
| LogP | 2.98 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |