Home
Products
Lusianthridin
| Product Name | Lusianthridin |
| Price: | $541 / 5mg |
| Catalog No.: | CN03819 |
| CAS No.: | 87530-30-1 |
| Molecular Formula: | C15H14O3 |
| Molecular Weight: | 242.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The herbs of Dendrobium nobile Lindl. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(O)c2c(c1)CCc1c2ccc(c1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Lusianthridin, a pure compound from Dendrobium venustum, have an anti-migratory effect. Lusianthridin enhances c-Myc degradation through the inhibition of Src-STAT3 signaling[1]. |
| In Vitro | Lusianthridin (0-100 μM) inhibits cell viability at concentrations greater than 50 μM in both H460 and H292 cells[1]. Lusianthridin significantly reduces the CSC populations in both H460 and H292 cells of the CSC spheres, with a significant decrease in the size of the H460 CSC spheres by approximately 10%, 63%, and 77% at day 3 at concentration 5, 10, and 20 μM Lusianthridin, respectively[1]. Cell Viability Assay[1] Cell Line: The human non-small cell lung cancer cell lines, NCI-H460, and NCI-H292 cells[1].0-100 μM. Concentration: 0-100 μM. Incubation Time: 24 h. Result: Caused a significant reduction in terms of cell viability at concentrations greater than 50 μM in both H460 and H292 cells. |
| Exact Mass | 242.09400 |
| PSA | 49.69000 |
| LogP | 2.87200 |