Home
Products
Liriopesides B
| Product Name | Liriopesides B |
| Price: | $109 / 10mg |
| Catalog No.: | CN02429 |
| CAS No.: | 87425-34-1 |
| Molecular Formula: | C39H62O12 |
| Molecular Weight: | 722.9 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The roots of Liriope spicata (Thunb.) Lour |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | CC1CCC2(OC1)OC1C(C2C)C2(C(C1)C1CC=C3C(C1CC2)(C)C(CC(C3)OC1OC(C)C(C(C1O)O)O)OC1OC(C)C(C(C1O)O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Liriopesides B (Nolinospiroside F) is a steroidal saponin isolated from Ophiopogon japonicas. Liriopesides B has anti-oxidative and anti-aging effects[1]. |
| In Vitro | Liriopesides B (Nolinospiroside F) increases SIRT1 activity[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 823.3±65.0 °C at 760 mmHg |
| Flash Point | 451.7±34.3 °C |
| Exact Mass | 722.424133 |
| PSA | 176.76000 |
| LogP | 5.42 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Storage condition | 2-8℃ |