Home
Products
3,29-Dibenzoyl karounitriol
| Product Name | 3,29-Dibenzoyl karounitriol |
| Price: | $117 / 10mg |
| Catalog No.: | CN07573 |
| CAS No.: | 873001-54-8 |
| Molecular Formula: | C44H58O5 |
| Molecular Weight: | 666.94 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Trichosanthes kirilowii Maxim |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(c1ccccc1)OC[C@]1(C)CC[C@]2([C@@H](C1)[C@]1(C)CCC3=C([C@]1(CC2)C)[C@@H](O)C[C@@H]1[C@]3(C)CC[C@H](C1(C)C)OC(=O)c1ccccc1)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3,29-Dibenzoyl rarounitriol is one major bioactive compound of multiflorane triterpene esters Trichosanthes kirilowii, can be chosen as the marker for quantitation of Trichosanthes kirilowii[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 706.5±60.0 °C at 760 mmHg |
| Flash Point | 203.9±26.4 °C |
| Exact Mass | 666.428406 |
| PSA | 72.83000 |
| LogP | 13.08 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Storage condition | 2~8℃ |