Home
Products
5-Hydroxy-1,7-diphenyl-6-hepten-3-one
| Product Name | 5-Hydroxy-1,7-diphenyl-6-hepten-3-one |
| Price: | $176 / 10mg |
| Catalog No.: | CN03964 |
| CAS No.: | 87095-74-7 |
| Molecular Formula: | C19H20O2 |
| Molecular Weight: | 280.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Curcuma longa L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@H](CC(=O)CCc1ccccc1)/C=C/c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (5R,6E)-5-Hydroxy-1,7-diphenyl-6-hepten-3-one is the methylene chloride extract of Alpinia nutans, has antioxidant activity[1]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 488.6±33.0 °C at 760 mmHg |
| Flash Point | 207.3±18.0 °C |
| Exact Mass | 280.146332 |
| PSA | 37.30000 |
| LogP | 3.46 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |