Home
Products
Tartaric acid
| Product Name | Tartaric acid |
| Price: | $15 / 25mg |
| Catalog No.: | CN06534 |
| CAS No.: | 87-69-4 |
| Molecular Formula: | C4H6O6 |
| Molecular Weight: | 150.09 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The seeds of Vitis vinifera L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@H]([C@H](C(=O)O)O)C(=O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.76 |
| Boiling Point | 399.3±42.0 °C at 760 mmHg |
| Flash Point | 210 ºC |
| Exact Mass | 150.016434 |
| PSA | 115.06000 |
| LogP | -1.43 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |