Home
Products
2''-O-Beta-L-Galorientin
| Product Name | 2''-O-Beta-L-Galorientin |
| Price: | $204 / 20mg |
| Catalog No.: | CN04829 |
| CAS No.: | 861691-37-4 |
| Molecular Formula: | C27H30O16 |
| Molecular Weight: | 610.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Trollius chinensis Bunge |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(C(C(C1O)O)OC1OC(CO)C(C(C1O)O)O)c1c(O)cc(c2c1oc(cc2=O)c1ccc(c(c1)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 2"-O-beta-L-galactopyranosylorientin is extracted from the flowers of Trollius ledebouri. 2"-O-beta-L-galactopyranosylorientin involves transporter mediated efflux in addition to passive diffusion and is the substrate of multidrug resistance protein 2 (MRP2)[1][2]. |
| Density | 1.87 |
| Boiling Point | 988.9±65.0 °C at 760 mmHg |
| Flash Point | 327.3±27.8 °C |
| Exact Mass | 610.153381 |
| PSA | 280.43000 |
| LogP | -0.99 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |