Home
Products
5,7,3',4'-Tetramethoxyflavone
| Product Name | 5,7,3',4'-Tetramethoxyflavone |
| Price: | $263 / 10mg |
| Catalog No.: | CN04455 |
| CAS No.: | 855-97-0 |
| Molecular Formula: | C19H18O6 |
| Molecular Weight: | 342.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Camellia sinensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(OC)c2c(c1)oc(cc2=O)c1ccc(c(c1)OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 5,7,3',4'-Tetramethoxyflavone, one of the major polymethoxyflavones (PMFs) isolated from M. exotica, possesses various bioactivities, including anti-fungal, anti-malarial, anti-mycobacterial, and anti-inflammatory activities. 5,7,3',4'-Tetramethoxyflavone exhibits chondroprotective activity by targeting β-catenin signaling[1]. |
| Density | 1.243g/cm3 |
| Boiling Point | 528.8ºC at 760 mmHg |
| Flash Point | 233.9ºC |
| Exact Mass | 342.11000 |
| PSA | 67.13000 |
| LogP | 3.49440 |