Home
Products
Eupatorin
| Product Name | Eupatorin |
| Price: | $263 / 10mg |
| Catalog No.: | CN05241 |
| CAS No.: | 855-96-9 |
| Molecular Formula: | C18H16O7 |
| Molecular Weight: | 344.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Eupatorium semiserratum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2oc(cc(=O)c2c(c1OC)O)c1ccc(c(c1)O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Eupatorin, a naturally occurring flavone, arrests cells at the G2-M phase of the cell cycle and induces apoptotic cell death involving activation of multiple caspases, mitochondrial release of cytochrome c and poly(ADP-ribose) polymerase cleavage[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 587.0±50.0 °C at 760 mmHg |
| Flash Point | 216.0±23.6 °C |
| Exact Mass | 344.089600 |
| PSA | 98.36000 |
| LogP | 2.96 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Storage condition | room temp |