Home
Products
Sculponeatin A
| Product Name | Sculponeatin A |
| Price: | Inquiry |
| Catalog No.: | CN08748 |
| CAS No.: | 85287-60-1 |
| Molecular Formula: | C20H24O6 |
| Molecular Weight: | 360.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Cryst. |
| Source: | The herbs of Rabdosia amethystoides |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C=C1C2CC(C3C(C1=O)(C2)C(=O)OC1C23COC3C2C(CC1)(C)CO3)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Sculponeatin B is a diterpenoid compound from the plant of the genus Rabdosia, Labiatae[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 600.4±55.0 °C at 760 mmHg |
| Flash Point | 218.7±25.0 °C |
| Exact Mass | 360.157288 |
| PSA | 82.06000 |
| LogP | -0.73 |
| Vapour Pressure | 0.0±3.9 mmHg at 25°C |