Home
Products
Dihydroartemisinic acid
| Product Name | Dihydroartemisinic acid |
| Price: | $54 / 20mg |
| Catalog No.: | CN09039 |
| CAS No.: | 85031-59-0 |
| Molecular Formula: | C15H24O2 |
| Molecular Weight: | 236.35 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Artemisia annua L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC(=O)[C@@H]([C@@H]1CC[C@H]([C@H]2[C@@H]1C=C(C)CC2)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Dihydroartemisinic acid (Dihydroqinghao acid), isolated as a natural product from Artemisia annua, is a biosynthetic precursor to the antimalarial agent Artemisinin[1]. |
| Exact Mass | 236.17800 |
| PSA | 37.30000 |
| LogP | 3.72570 |
| Storage condition | -20℃ |