Home
Products
Rosin
| Product Name | Rosin |
| Price: | $219 / 10mg |
| Catalog No.: | CN07022 |
| CAS No.: | 85026-55-7 |
| Molecular Formula: | C15H20O6 |
| Molecular Weight: | 296.32 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Rhodiola rosea L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](OC/C=C/c2ccccc2)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Rosin is isolated from pine wood or pine stumps, Rosin is a frequent contact allergen which induces allergic contact dermatitis[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 542.4±50.0 °C at 760 mmHg |
| Flash Point | 281.8±30.1 °C |
| Exact Mass | 296.125977 |
| PSA | 99.38000 |
| LogP | -0.31 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Storage condition | 2-8°C |