Home
Products
Shikonofuran A
| Product Name | Shikonofuran A |
| Price: | $293 / 5mg |
| Catalog No.: | CN06553 |
| CAS No.: | 85022-66-8 |
| Molecular Formula: | C18H20O5 |
| Molecular Weight: | 316.35 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The roots of Lithosperraum erythrorhizon Sieb. et Zucc. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)OC(c1coc(c1)c1cc(O)ccc1O)CC=C(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Shikonofuran A is a natural product isolated from the root of Lithosperraum erythrorhizon Sieb. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 358.4±21.0 °C at 760 mmHg |
| Flash Point | 170.5±22.1 °C |
| Exact Mass | 316.131073 |
| PSA | 79.90000 |
| LogP | 3.13 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Storage condition | 2-8°C |