Home
Products
Sudan III
| Product Name | Sudan III |
| Price: | $23 / 20mg |
| Catalog No.: | CN00948 |
| CAS No.: | 85-86-9 |
| Molecular Formula: | C22H16N4O |
| Molecular Weight: | 352.39 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | From chilli and paprika spice. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc2c(c1/N=N/c1ccc(cc1)/N=N/c1ccccc1)cccc2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Sudan III is a lysochrome (fat-soluble dye) diazo dye. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 584.6±35.0 °C at 760 mmHg |
| Flash Point | 398.1±15.2 °C |
| Exact Mass | 352.132416 |
| PSA | 69.67000 |
| LogP | 5.74 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |