Home
Products
5'-Guanylic acid
| Product Name | 5'-Guanylic acid |
| Price: | Inquiry |
| Catalog No.: | CN00087 |
| CAS No.: | 85-32-5 |
| Molecular Formula: | C10H14N5O8P |
| Molecular Weight: | 363.22 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@@H]1[C@H](O)[C@H](O[C@H]1n1cnc2c1nc(N)[nH]c2=O)COP(=O)(O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Guanylic acid is involved in several metabolic disorders, including the AICA-ribosiduria pathway, adenosine deaminase deficiency, adenine phosphoribosyltransferase deficiency (aprt), and the 2-hydroxyglutric aciduria pathway. |
| Target | Human Endogenous Metabolite |
| Density | 2.5±0.1 g/cm3 |
| Boiling Point | 872.4±75.0 °C at 760 mmHg |
| Flash Point | 481.4±37.1 °C |
| Exact Mass | 363.057983 |
| PSA | 215.85000 |
| LogP | -1.97 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | Store at 0-5°C |