Home
Products
Deapi-platycoside E
| Product Name | Deapi-platycoside E |
| Price: | $348 / 5mg |
| Catalog No.: | CN07668 |
| CAS No.: | 849758-42-5 |
| Molecular Formula: | C64H104O34 |
| Molecular Weight: | 1417.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Platycodon grandiflorum. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](OC[C@H]3O[C@@H](O[C@H]4[C@@H](O)C[C@]5([C@H](C4(CO)CO)CC[C@@]4([C@@H]5CC=C5[C@@]4(C)C[C@H]([C@@]4([C@H]5CC(C)(C)CC4)C(=O)O[C@@H]4OC[C@@H]([C@@H]([C@H]4O[C@@H]4O[C@@H](C)[C@@H]([C@H]([C@H]4O)O)O[C@@H]4OC[C@H]([C@@H]([C@H]4O)O)O)O)O)O)C)C)[C@@H]([C@H]([C@@H]3O)O)O)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Platycoside G1, a natural product found in Platycodon grandiflorum, is a triterpenoid saponin. Platycoside G1 has potent antioxidant activities[1]. |
| Density | 1.6±0.1 g/cm3 |
| Exact Mass | 1416.640869 |
| LogP | -1.50 |