Home
Products
Rosavin
| Product Name | Rosavin |
| Price: | $46 / 20mg |
| Catalog No.: | CN07023 |
| CAS No.: | 84954-92-7 |
| Molecular Formula: | C20H28O10 |
| Molecular Weight: | 428.43 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Rhodiola rosea L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O[C@@H]1[C@@H](O)[C@H](OC/C=C/c2ccccc2)O[C@@H]([C@H]1O)CO[C@@H]1OC[C@@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Rosavin is isolated from R. rosea, Rosavin shows antidepressant-like, adaptogenic, anxiolytic-like effects in mice model[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 709.1±60.0 °C at 760 mmHg |
| Flash Point | 382.6±32.9 °C |
| Exact Mass | 428.168243 |
| PSA | 158.30000 |
| LogP | 1.83 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Storage condition | ?20°C |