Home
Products
Eriocalyxin B
| Product Name | Eriocalyxin B |
| Price: | Inquiry |
| Catalog No.: | CN08750 |
| CAS No.: | 84745-95-9 |
| Molecular Formula: | C20H24O5 |
| Molecular Weight: | 344.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Isodon eriocalyx. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C=C1[C@@H]2CC[C@@H]3[C@](C1=O)(C2)[C@]1(O)OC[C@@]23C(=O)C=CC([C@H]2[C@@H]1O)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Eriocalyxin B is an ent-Kaurene diterpenoid isolated from Chinese herb Isodon eriocalyx. Eriocalyxin B has anti-cancer and anti-infammatory activities. Eriocalyxin B induces cell apoptosis[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 551.1±50.0 °C at 760 mmHg |
| Flash Point | 198.9±23.6 °C |
| Exact Mass | 344.162384 |
| PSA | 83.83000 |
| LogP | 2.16 |
| Vapour Pressure | 0.0±3.4 mmHg at 25°C |