Home
Products
Qingyangshengenin
| Product Name | Qingyangshengenin |
| Price: | $117 / 10mg |
| Catalog No.: | CN02496 |
| CAS No.: | 84745-94-8 |
| Molecular Formula: | C28H36O8 |
| Molecular Weight: | 500.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Cryst. |
| Source: | The roots of Cynanchum otophyllum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@H]1CC[C@]2(C(=CC[C@@]3([C@@H]2C[C@@H](OC(=O)c2ccc(cc2)O)[C@]2([C@]3(O)CC[C@@]2(O)C(=O)C)C)O)C1)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Qingyanshengenin (NSC 379666; compound 2), a pregnane glycoside, is a C21 steroidal aglycone isolated from the root of Cynanchumot ophyllum (Asclepiadaceae). Qingyanshengenin has anti-cancer activity[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 686.4±55.0 °C at 760 mmHg |
| Flash Point | 226.2±25.0 °C |
| Exact Mass | 500.241028 |
| PSA | 144.52000 |
| LogP | 3.51 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |