Home
Products
alpha-Arbutin
| Product Name | alpha-Arbutin |
| Price: | $15 / 20mg |
| Catalog No.: | CN03303 |
| CAS No.: | 84380-01-8 |
| Molecular Formula: | C12H16O7 |
| Molecular Weight: | 272.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The leaves of Arctostaphylos uvaursi |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@H](Oc2ccc(cc2)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | α-Arbutin (4-Hydroxyphenyl α-D-glucopyranoside) is emerging as popular and effective skin whiteners, acting as tyrosinase inhibitor[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 561.6±50.0 °C at 760 mmHg |
| Flash Point | 293.4±30.1 °C |
| Exact Mass | 272.089600 |
| PSA | 119.61000 |
| LogP | -1.35 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Storage condition | 2-8°C |