Home
Products
6,7-Dimethoxy-2-phenethylchromone
| Product Name | 6,7-Dimethoxy-2-phenethylchromone |
| Price: | $439 / 10mg |
| Catalog No.: | CN03422 |
| CAS No.: | 84294-87-1 |
| Molecular Formula: | C19H18O4 |
| Molecular Weight: | 310.34 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The herbs of Aquilaria sinensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2oc(CCc3ccccc3)cc(=O)c2cc1OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 6,7-Dimethoxy-2-(2-phenylethyl)chromone is a natural compound[1]. |
| Exact Mass | 310.12100 |
| PSA | 48.67000 |
| LogP | 3.59540 |