Home
Products
Lapachol
| Product Name | Lapachol |
| Price: | $62 / 20mg |
| Catalog No.: | CN05898 |
| CAS No.: | 84-79-7 |
| Molecular Formula: | C15H14O3 |
| Molecular Weight: | 242.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Quinones |
| Physical Desc.: | Yellow powder |
| Source: | The roots of Radermachera sinica |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCC1=C(O)C(=O)c2c(C1=O)cccc2)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Lapachol is a naphthoquinone that was first isolated from Tabebuia avellanedae (Bignoniaceae). Lapachol shows anti-infection and antitumor activity[1] |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 390.1±42.0 °C at 760 mmHg |
| Flash Point | 203.9±24.4 °C |
| Exact Mass | 242.094299 |
| PSA | 54.37000 |
| LogP | 4.08 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |